C35H56O7 — CID 72793803
(3E,5E,11E,13E)-16-[(E)-3,9-dihydroxy-4,8,10-trimethyl-5-oxoundec-6-en-2-yl]-8-hydroxy-15-methoxy-3,5,7,9,11-pentamethyl-1-oxacyclohexadeca-3,5,11,13-tetraen-2-one (PubChem CID 72793803) has the molecular formula C35H56O7 and a molecular weight of 588.83 g/mol. Its IUPAC name is (3E,5E,11E,13E)-16-[(E)-3,9-dihydroxy-4,8,10-trimethyl-5-oxoundec-6-en-2-yl]-8-hydroxy-15-methoxy-3,5,7,9,11-pentamethyl-1-oxacyclohexadeca-3,5,11,13-tetraen-2-one.
| Compound Name | (3E,5E,11E,13E)-16-[(E)-3,9-dihydroxy-4,8,10-trimethyl-5-oxoundec-6-en-2-yl]-8-hydroxy-15-methoxy-3,5,7,9,11-pentamethyl-1-oxacyclohexadeca-3,5,11,13-tetraen-2-one |
|---|---|
| PubChem CID | 72793803 |
| Molecular Formula | C35H56O7 |
| Molecular Weight | 588.83 g/mol |
| Exact Mass | 588.40 |
| IUPAC Name | (3E,5E,11E,13E)-16-[(E)-3,9-dihydroxy-4,8,10-trimethyl-5-oxoundec-6-en-2-yl]-8-hydroxy-15-methoxy-3,5,7,9,11-pentamethyl-1-oxacyclohexadeca-3,5,11,13-tetraen-2-one |
| SMILES | COC1/C=C/C=C(\C)CC(C)C(O)C(C)/C=C(C)/C=C(\C)C(=O)OC1C(C)C(O)C(C)C(=O)/C=C/C(C)C(O)C(C)C |
| InChI | InChI=1S/C35H56O7/c1-20(2)31(37)23(5)15-16-29(36)27(9)33(39)28(10)34-30(41-11)14-12-13-21(3)17-24(6)32(38)25(7)18-22(4)19-26(8)35(40)42-34/h12-16,18-20,23-25,27-28,30-34,37-39H,17H2,1-11H3/b14-12+,16-15+,21-13+,22-18+,26-19+ |
| InChIKey | PTZODBXYFQYQFX-HGYALMGGSA-N |
| XLogP | 5.76 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.83 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|