C19H21N5O5 — CID 7279568
(3S)-1-(4-ethoxyphenyl)-3-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrrolidine-2,5-dione (PubChem CID 7279568) has the molecular formula C19H21N5O5 and a molecular weight of 399.41 g/mol. Its IUPAC name is (3S)-1-(4-ethoxyphenyl)-3-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(4-ethoxyphenyl)-3-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7279568 |
| Molecular Formula | C19H21N5O5 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (3S)-1-(4-ethoxyphenyl)-3-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrrolidine-2,5-dione |
| SMILES | CCOc1ccc(N2C(=O)C[C@H](NCCNc3ccc([N+](=O)[O-])cn3)C2=O)cc1 |
| InChI | InChI=1S/C19H21N5O5/c1-2-29-15-6-3-13(4-7-15)23-18(25)11-16(19(23)26)20-9-10-21-17-8-5-14(12-22-17)24(27)28/h3-8,12,16,20H,2,9-11H2,1H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | ZKLPAGVDBAQZPP-INIZCTEOSA-N |
| XLogP | 1.72 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|