About 2-phenyltricyclo[3.2.1.02,4]oct-6-ene
2-phenyltricyclo[3.2.1.02,4]oct-6-ene (PubChem CID 72795996) has the molecular formula C14H14
and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-phenyltricyclo[3.2.1.02,4]oct-6-ene.
Molecular Properties
| Compound Name | 2-phenyltricyclo[3.2.1.02,4]oct-6-ene |
| PubChem CID | 72795996 |
| Molecular Formula | C14H14 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2-phenyltricyclo[3.2.1.02,4]oct-6-ene |
| SMILES | C1=CC2CC1C1CC21c1ccccc1 |
| InChI | InChI=1S/C14H14/c1-2-4-11(5-3-1)14-9-13(14)10-6-7-12(14)8-10/h1-7,10,12-13H,8-9H2 |
| InChIKey | GPNRWNMRTZVHAX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyltricyclo[3.2.1.02,4]oct-6-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyltricyclo[3.2.1.02,4]oct-6-ene?
The IUPAC name of 2-phenyltricyclo[3.2.1.02,4]oct-6-ene (CID 72795996) is 2-phenyltricyclo[3.2.1.02,4]oct-6-ene.
What is the SMILES notation for 2-phenyltricyclo[3.2.1.02,4]oct-6-ene?
The canonical SMILES for 2-phenyltricyclo[3.2.1.02,4]oct-6-ene is C1=CC2CC1C1CC21c1ccccc1.
What is the InChIKey of 2-phenyltricyclo[3.2.1.02,4]oct-6-ene?
The InChIKey is GPNRWNMRTZVHAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14/c1-2-4-11(5-3-1)14-9-13(14)10-6-7-12(14)8-10/h1-7,10,12-13H,8-9H2.
What are the key properties of 2-phenyltricyclo[3.2.1.02,4]oct-6-ene?
2-phenyltricyclo[3.2.1.02,4]oct-6-ene has a molecular weight of 182.27 g/mol, XLogP of 3.15, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyltricyclo[3.2.1.02,4]oct-6-ene is sourced from PubChem (CID 72795996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).