About 2-(hexa-2,4-dienoylamino)acetic acid
2-(hexa-2,4-dienoylamino)acetic acid (PubChem CID 72797015) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-(hexa-2,4-dienoylamino)acetic acid.
Molecular Properties
| Compound Name | 2-(hexa-2,4-dienoylamino)acetic acid |
| PubChem CID | 72797015 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 2-(hexa-2,4-dienoylamino)acetic acid |
| SMILES | CC=CC=CC(=O)NCC(=O)O |
| InChI | InChI=1S/C8H11NO3/c1-2-3-4-5-7(10)9-6-8(11)12/h2-5H,6H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | NRJHPYHCLIMQOK-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-(hexa-2,4-dienoylamino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hexa-2,4-dienoylamino)acetic acid?
The IUPAC name of 2-(hexa-2,4-dienoylamino)acetic acid (CID 72797015) is 2-(hexa-2,4-dienoylamino)acetic acid.
What is the SMILES notation for 2-(hexa-2,4-dienoylamino)acetic acid?
The canonical SMILES for 2-(hexa-2,4-dienoylamino)acetic acid is CC=CC=CC(=O)NCC(=O)O.
What is the InChIKey of 2-(hexa-2,4-dienoylamino)acetic acid?
The InChIKey is NRJHPYHCLIMQOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c1-2-3-4-5-7(10)9-6-8(11)12/h2-5H,6H2,1H3,(H,9,10)(H,11,12).
What are the key properties of 2-(hexa-2,4-dienoylamino)acetic acid?
2-(hexa-2,4-dienoylamino)acetic acid has a molecular weight of 169.18 g/mol, XLogP of 0.32, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hexa-2,4-dienoylamino)acetic acid is sourced from PubChem (CID 72797015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).