C37H55NO10 — CID 72799876
(PubChem CID 72799876) has the molecular formula C37H55NO10 and a molecular weight of 673.84 g/mol.
| Compound Name | |
|---|---|
| PubChem CID | 72799876 |
| Molecular Formula | C37H55NO10 |
| Molecular Weight | 673.84 g/mol |
| Exact Mass | 673.38 |
| IUPAC Name | — |
| SMILES | CCC1OC(=O)C(C)C(=O)C(C)C(OC2OC(C)CC(N(C)C)C2OC(=O)c2ccccc2)C(C)(OC)CC(C)C(=O)C(C)=CC1(C)O |
| InChI | InChI=1S/C37H55NO10/c1-12-28-36(7,43)19-21(2)29(39)22(3)20-37(8,44-11)32(24(5)30(40)25(6)33(41)46-28)48-35-31(27(38(9)10)18-23(4)45-35)47-34(42)26-16-14-13-15-17-26/h13-17,19,22-25,27-28,31-32,35,43H,12,18,20H2,1-11H3 |
| InChIKey | ZHLSXNLCQSCHHR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 137.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.84 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|