C18H21N4O3S+ — CID 7280233
(5R)-5-(4-nitrophenyl)-11-propan-2-yl-8-thia-4,6-diaza-11-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one (PubChem CID 7280233) has the molecular formula C18H21N4O3S+ and a molecular weight of 373.46 g/mol. Its IUPAC name is (5R)-5-(4-nitrophenyl)-11-propan-2-yl-8-thia-4,6-diaza-11-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one.
| Compound Name | (5R)-5-(4-nitrophenyl)-11-propan-2-yl-8-thia-4,6-diaza-11-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
|---|---|
| PubChem CID | 7280233 |
| Molecular Formula | C18H21N4O3S+ |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (5R)-5-(4-nitrophenyl)-11-propan-2-yl-8-thia-4,6-diaza-11-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
| SMILES | CC(C)[NH+]1CCc2c(sc3c2C(=O)N[C@@H](c2ccc([N+](=O)[O-])cc2)N3)C1 |
| InChI | InChI=1S/C18H20N4O3S/c1-10(2)21-8-7-13-14(9-21)26-18-15(13)17(23)19-16(20-18)11-3-5-12(6-4-11)22(24)25/h3-6,10,16,20H,7-9H2,1-2H3,(H,19,23)/p+1/t16-/m1/s1 |
| InChIKey | VZIVTXWHRMLXJB-MRXNPFEDSA-O |
| XLogP | 1.86 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|