C23H27N5O3 — CID 72802880
2-(1,3-benzodioxol-5-yl)-N-[1-[[(cyanoamino)-(2-methylanilino)methylidene]amino]-2,2-dimethylpropyl]acetamide (PubChem CID 72802880) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[1-[[(cyanoamino)-(2-methylanilino)methylidene]amino]-2,2-dimethylpropyl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[1-[[(cyanoamino)-(2-methylanilino)methylidene]amino]-2,2-dimethylpropyl]acetamide |
|---|---|
| PubChem CID | 72802880 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[1-[[(cyanoamino)-(2-methylanilino)methylidene]amino]-2,2-dimethylpropyl]acetamide |
| SMILES | Cc1ccccc1NC(=NC(NC(=O)Cc1ccc2c(c1)OCO2)C(C)(C)C)NC#N |
| InChI | InChI=1S/C23H27N5O3/c1-15-7-5-6-8-17(15)26-22(25-13-24)28-21(23(2,3)4)27-20(29)12-16-9-10-18-19(11-16)31-14-30-18/h5-11,21H,12,14H2,1-4H3,(H,27,29)(H2,25,26,28) |
| InChIKey | LSEJOJKLDAHQPT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|