C18H28FN3O3S — CID 7280389
1-tert-butyl-3-[2-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]ethyl]urea (PubChem CID 7280389) has the molecular formula C18H28FN3O3S and a molecular weight of 385.51 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]ethyl]urea.
| Compound Name | 1-tert-butyl-3-[2-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 7280389 |
| Molecular Formula | C18H28FN3O3S |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-tert-butyl-3-[2-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]ethyl]urea |
| SMILES | CC(C)(C)NC(=O)NCC[C@@H]1CCCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H28FN3O3S/c1-18(2,3)21-17(23)20-12-11-15-6-4-5-13-22(15)26(24,25)16-9-7-14(19)8-10-16/h7-10,15H,4-6,11-13H2,1-3H3,(H2,20,21,23)/t15-/m0/s1 |
| InChIKey | KJPNAORGUSYURE-HNNXBMFYSA-N |
| XLogP | 2.86 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |