C30H39N5O5S — CID 72804126
1-cyclopentyl-3-[3-[3-[(4-methylsulfonylphenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-1-phenylpropyl]urea (PubChem CID 72804126) has the molecular formula C30H39N5O5S and a molecular weight of 581.74 g/mol. Its IUPAC name is 1-cyclopentyl-3-[3-[3-[(4-methylsulfonylphenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-1-phenylpropyl]urea.
| Compound Name | 1-cyclopentyl-3-[3-[3-[(4-methylsulfonylphenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-1-phenylpropyl]urea |
|---|---|
| PubChem CID | 72804126 |
| Molecular Formula | C30H39N5O5S |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.27 |
| IUPAC Name | 1-cyclopentyl-3-[3-[3-[(4-methylsulfonylphenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-1-phenylpropyl]urea |
| SMILES | CS(=O)(=O)c1ccc(CN2C(=O)NC3(CCN(CCC(NC(=O)NC4CCCC4)c4ccccc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C30H39N5O5S/c1-41(39,40)25-13-11-22(12-14-25)21-35-27(36)30(33-29(35)38)16-19-34(20-17-30)18-15-26(23-7-3-2-4-8-23)32-28(37)31-24-9-5-6-10-24/h2-4,7-8,11-14,24,26H,5-6,9-10,15-21H2,1H3,(H,33,38)(H2,31,32,37) |
| InChIKey | GJSRDXYAAIMEEB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|