C21H26O7 — CID 72807187
dimethyl 11-butyl-2-oxo-3-prop-2-ynoxy-4-oxatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarboxylate (PubChem CID 72807187) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is dimethyl 11-butyl-2-oxo-3-prop-2-ynoxy-4-oxatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarboxylate.
| Compound Name | dimethyl 11-butyl-2-oxo-3-prop-2-ynoxy-4-oxatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 72807187 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | dimethyl 11-butyl-2-oxo-3-prop-2-ynoxy-4-oxatricyclo[5.3.1.03,8]undec-9-ene-9,10-dicarboxylate |
| SMILES | C#CCOC12OCCC3C(CCCC)C(C1=O)C(C(=O)OC)=C(C(=O)OC)C32 |
| InChI | InChI=1S/C21H26O7/c1-5-7-8-12-13-9-11-28-21(27-10-6-2)17(13)16(20(24)26-4)15(19(23)25-3)14(12)18(21)22/h2,12-14,17H,5,7-11H2,1,3-4H3 |
| InChIKey | JXCMQRRWMSTKSN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|