C12H15NO — CID 72810081
2,3,3a,7,8,9-hexahydro-1H-pyrrolo[1,2-a]quinolin-6-one (PubChem CID 72810081) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 2,3,3a,7,8,9-hexahydro-1H-pyrrolo[1,2-a]quinolin-6-one.
| Compound Name | 2,3,3a,7,8,9-hexahydro-1H-pyrrolo[1,2-a]quinolin-6-one |
|---|---|
| PubChem CID | 72810081 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2,3,3a,7,8,9-hexahydro-1H-pyrrolo[1,2-a]quinolin-6-one |
| SMILES | O=C1CCCC2=C1C=CC1CCCN21 |
| InChI | InChI=1S/C12H15NO/c14-12-5-1-4-11-10(12)7-6-9-3-2-8-13(9)11/h6-7,9H,1-5,8H2 |
| InChIKey | CNFPDQOWNXJKDV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |