C7H10O2 — CID 72814695
4-methyl-7-oxabicyclo[2.2.1]heptan-2-one (PubChem CID 72814695) has the molecular formula C7H10O2 and a molecular weight of 126.16 g/mol. Its IUPAC name is 4-methyl-7-oxabicyclo[2.2.1]heptan-2-one.
| Compound Name | 4-methyl-7-oxabicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 72814695 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 4-methyl-7-oxabicyclo[2.2.1]heptan-2-one |
| SMILES | CC12CCC(O1)C(=O)C2 |
| InChI | InChI=1S/C7H10O2/c1-7-3-2-6(9-7)5(8)4-7/h6H,2-4H2,1H3 |
| InChIKey | VJMALISAQJXDLL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |