About 5-ethoxy-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid
5-ethoxy-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (PubChem CID 72815783) has the molecular formula C12H19F2NO6
and a molecular weight of 311.28 g/mol. Its IUPAC name is 5-ethoxy-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid.
Molecular Properties
| Compound Name | 5-ethoxy-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| PubChem CID | 72815783 |
| Molecular Formula | C12H19F2NO6 |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 5-ethoxy-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| SMILES | CCOC(=O)C(F)(F)CC(NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H19F2NO6/c1-5-20-9(18)12(13,14)6-7(8(16)17)15-10(19)21-11(2,3)4/h7H,5-6H2,1-4H3,(H,15,19)(H,16,17) |
| InChIKey | FHTYJERZVQLQOO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-ethoxy-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid?
The IUPAC name of 5-ethoxy-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (CID 72815783) is 5-ethoxy-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid.
What is the SMILES notation for 5-ethoxy-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid?
The canonical SMILES for 5-ethoxy-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid is CCOC(=O)C(F)(F)CC(NC(=O)OC(C)(C)C)C(=O)O.
What is the InChIKey of 5-ethoxy-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid?
The InChIKey is FHTYJERZVQLQOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F2NO6/c1-5-20-9(18)12(13,14)6-7(8(16)17)15-10(19)21-11(2,3)4/h7H,5-6H2,1-4H3,(H,15,19)(H,16,17).
What are the key properties of 5-ethoxy-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid?
5-ethoxy-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid has a molecular weight of 311.28 g/mol, XLogP of 1.55, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid is sourced from PubChem (CID 72815783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).