C27H32NO+ — CID 7281617
(2S,3R,4R,6S)-4-benzyl-2,6-diphenyl-3-propylpiperidin-1-ium-4-ol (PubChem CID 7281617) has the molecular formula C27H32NO+ and a molecular weight of 386.56 g/mol. Its IUPAC name is (2S,3R,4R,6S)-4-benzyl-2,6-diphenyl-3-propylpiperidin-1-ium-4-ol.
| Compound Name | (2S,3R,4R,6S)-4-benzyl-2,6-diphenyl-3-propylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7281617 |
| Molecular Formula | C27H32NO+ |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | (2S,3R,4R,6S)-4-benzyl-2,6-diphenyl-3-propylpiperidin-1-ium-4-ol |
| SMILES | CCC[C@@H]1[C@@H](c2ccccc2)[NH2+][C@H](c2ccccc2)C[C@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C27H31NO/c1-2-12-24-26(23-17-10-5-11-18-23)28-25(22-15-8-4-9-16-22)20-27(24,29)19-21-13-6-3-7-14-21/h3-11,13-18,24-26,28-29H,2,12,19-20H2,1H3/p+1/t24-,25+,26-,27-/m1/s1 |
| InChIKey | DWMBLMXBAOMOLC-HVWQDESWSA-O |
| XLogP | 4.83 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |