C38H42O11 — CID 72818695
(4,9-diacetyloxy-3-benzoyloxy-10-hydroxy-2,6,6,14-tetramethyl-11,16-dioxo-5-tricyclo[8.6.0.02,7]hexadec-13-enyl) benzoate (PubChem CID 72818695) has the molecular formula C38H42O11 and a molecular weight of 674.74 g/mol. Its IUPAC name is (4,9-diacetyloxy-3-benzoyloxy-10-hydroxy-2,6,6,14-tetramethyl-11,16-dioxo-5-tricyclo[8.6.0.02,7]hexadec-13-enyl) benzoate.
| Compound Name | (4,9-diacetyloxy-3-benzoyloxy-10-hydroxy-2,6,6,14-tetramethyl-11,16-dioxo-5-tricyclo[8.6.0.02,7]hexadec-13-enyl) benzoate |
|---|---|
| PubChem CID | 72818695 |
| Molecular Formula | C38H42O11 |
| Molecular Weight | 674.74 g/mol |
| Exact Mass | 674.27 |
| IUPAC Name | (4,9-diacetyloxy-3-benzoyloxy-10-hydroxy-2,6,6,14-tetramethyl-11,16-dioxo-5-tricyclo[8.6.0.02,7]hexadec-13-enyl) benzoate |
| SMILES | CC(=O)OC1C(OC(=O)c2ccccc2)C(C)(C)C2CC(OC(C)=O)C3(O)C(=O)CC=C(C)CC(=O)C3C2(C)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C38H42O11/c1-21-17-18-28(42)38(45)29(46-22(2)39)20-27-36(4,5)32(48-34(43)24-13-9-7-10-14-24)30(47-23(3)40)33(37(27,6)31(38)26(41)19-21)49-35(44)25-15-11-8-12-16-25/h7-17,27,29-33,45H,18-20H2,1-6H3 |
| InChIKey | MFPAGFFHWQHANG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.74 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|