C14H19BO2 — CID 72819693
4,4,6-trimethyl-2-(2-phenylethenyl)-1,3,2-dioxaborinane (PubChem CID 72819693) has the molecular formula C14H19BO2 and a molecular weight of 230.12 g/mol. Its IUPAC name is 4,4,6-trimethyl-2-(2-phenylethenyl)-1,3,2-dioxaborinane.
| Compound Name | 4,4,6-trimethyl-2-(2-phenylethenyl)-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 72819693 |
| Molecular Formula | C14H19BO2 |
| Molecular Weight | 230.12 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 4,4,6-trimethyl-2-(2-phenylethenyl)-1,3,2-dioxaborinane |
| SMILES | CC1CC(C)(C)OB(C=Cc2ccccc2)O1 |
| InChI | InChI=1S/C14H19BO2/c1-12-11-14(2,3)17-15(16-12)10-9-13-7-5-4-6-8-13/h4-10,12H,11H2,1-3H3 |
| InChIKey | NQDIFQCVHDAHPG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.12 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|