C9H19NO — CID 7282558
(4R,5S)-1,2,2,5-tetramethylpiperidin-4-ol (PubChem CID 7282558) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is (4R,5S)-1,2,2,5-tetramethylpiperidin-4-ol.
| Compound Name | (4R,5S)-1,2,2,5-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 7282558 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | (4R,5S)-1,2,2,5-tetramethylpiperidin-4-ol |
| SMILES | C[C@H]1CN(C)C(C)(C)C[C@H]1O |
| InChI | InChI=1S/C9H19NO/c1-7-6-10(4)9(2,3)5-8(7)11/h7-8,11H,5-6H2,1-4H3/t7-,8+/m0/s1 |
| InChIKey | VCTKUJRILCIKDW-JGVFFNPUSA-N |
| XLogP | 1.10 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |