About [(5S,7R)-3-[(1S)-1-azaniumylbutyl]-1-adamantyl]methylazanium
[(5S,7R)-3-[(1S)-1-azaniumylbutyl]-1-adamantyl]methylazanium (PubChem CID 7282714) has the molecular formula C15H30N2+2
and a molecular weight of 238.42 g/mol. Its IUPAC name is [(5S,7R)-3-[(1S)-1-azaniumylbutyl]-1-adamantyl]methylazanium.
Molecular Properties
| Compound Name | [(5S,7R)-3-[(1S)-1-azaniumylbutyl]-1-adamantyl]methylazanium |
| PubChem CID | 7282714 |
| Molecular Formula | C15H30N2+2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | [(5S,7R)-3-[(1S)-1-azaniumylbutyl]-1-adamantyl]methylazanium |
| SMILES | CCC[C@H]([NH3+])C12C[C@@H]3C[C@@H](CC(C[NH3+])(C3)C1)C2 |
| InChI | InChI=1S/C15H28N2/c1-2-3-13(17)15-7-11-4-12(8-15)6-14(5-11,9-15)10-16/h11-13H,2-10,16-17H2,1H3/p+2/t11-,12+,13-,14?,15?/m0/s1 |
| InChIKey | WIRGLDXYFVCGGN-SORZLVKCSA-P |
| XLogP | 1.23 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze [(5S,7R)-3-[(1S)-1-azaniumylbutyl]-1-adamantyl]methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S,7R)-3-[(1S)-1-azaniumylbutyl]-1-adamantyl]methylazanium?
The IUPAC name of [(5S,7R)-3-[(1S)-1-azaniumylbutyl]-1-adamantyl]methylazanium (CID 7282714) is [(5S,7R)-3-[(1S)-1-azaniumylbutyl]-1-adamantyl]methylazanium.
What is the SMILES notation for [(5S,7R)-3-[(1S)-1-azaniumylbutyl]-1-adamantyl]methylazanium?
The canonical SMILES for [(5S,7R)-3-[(1S)-1-azaniumylbutyl]-1-adamantyl]methylazanium is CCC[C@H]([NH3+])C12C[C@@H]3C[C@@H](CC(C[NH3+])(C3)C1)C2.
What is the InChIKey of [(5S,7R)-3-[(1S)-1-azaniumylbutyl]-1-adamantyl]methylazanium?
The InChIKey is WIRGLDXYFVCGGN-SORZLVKCSA-P. The full InChI is InChI=1S/C15H28N2/c1-2-3-13(17)15-7-11-4-12(8-15)6-14(5-11,9-15)10-16/h11-13H,2-10,16-17H2,1H3/p+2/t11-,12+,13-,14?,15?/m0/s1.
What are the key properties of [(5S,7R)-3-[(1S)-1-azaniumylbutyl]-1-adamantyl]methylazanium?
[(5S,7R)-3-[(1S)-1-azaniumylbutyl]-1-adamantyl]methylazanium has a molecular weight of 238.42 g/mol, XLogP of 1.23, 4 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S,7R)-3-[(1S)-1-azaniumylbutyl]-1-adamantyl]methylazanium is sourced from PubChem (CID 7282714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).