About tert-butyl 2-[6-(2-iodoethenyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate
tert-butyl 2-[6-(2-iodoethenyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (PubChem CID 72830276) has the molecular formula C14H23IO4
and a molecular weight of 382.24 g/mol. Its IUPAC name is tert-butyl 2-[6-(2-iodoethenyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[6-(2-iodoethenyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| PubChem CID | 72830276 |
| Molecular Formula | C14H23IO4 |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | tert-butyl 2-[6-(2-iodoethenyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1CC(C=CI)OC(C)(C)O1 |
| InChI | InChI=1S/C14H23IO4/c1-13(2,3)19-12(16)9-11-8-10(6-7-15)17-14(4,5)18-11/h6-7,10-11H,8-9H2,1-5H3 |
| InChIKey | RMHLMCRMFNOHBO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[6-(2-iodoethenyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[6-(2-iodoethenyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate?
The IUPAC name of tert-butyl 2-[6-(2-iodoethenyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CID 72830276) is tert-butyl 2-[6-(2-iodoethenyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate.
What is the SMILES notation for tert-butyl 2-[6-(2-iodoethenyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate?
The canonical SMILES for tert-butyl 2-[6-(2-iodoethenyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate is CC(C)(C)OC(=O)CC1CC(C=CI)OC(C)(C)O1.
What is the InChIKey of tert-butyl 2-[6-(2-iodoethenyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate?
The InChIKey is RMHLMCRMFNOHBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23IO4/c1-13(2,3)19-12(16)9-11-8-10(6-7-15)17-14(4,5)18-11/h6-7,10-11H,8-9H2,1-5H3.
What are the key properties of tert-butyl 2-[6-(2-iodoethenyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate?
tert-butyl 2-[6-(2-iodoethenyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate has a molecular weight of 382.24 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[6-(2-iodoethenyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate is sourced from PubChem (CID 72830276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).