About 5-methoxy-2-[4-(1,3-thiazol-4-yl)-1H-pyrazol-5-yl]phenol
5-methoxy-2-[4-(1,3-thiazol-4-yl)-1H-pyrazol-5-yl]phenol (PubChem CID 728350) has the molecular formula C13H11N3O2S
and a molecular weight of 273.32 g/mol. Its IUPAC name is 5-methoxy-2-[4-(1,3-thiazol-4-yl)-1H-pyrazol-5-yl]phenol.
Molecular Properties
| Compound Name | 5-methoxy-2-[4-(1,3-thiazol-4-yl)-1H-pyrazol-5-yl]phenol |
| PubChem CID | 728350 |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 5-methoxy-2-[4-(1,3-thiazol-4-yl)-1H-pyrazol-5-yl]phenol |
| SMILES | COc1ccc(-c2[nH]ncc2-c2cscn2)c(O)c1 |
| InChI | InChI=1S/C13H11N3O2S/c1-18-8-2-3-9(12(17)4-8)13-10(5-15-16-13)11-6-19-7-14-11/h2-7,17H,1H3,(H,15,16) |
| InChIKey | GKWZJPNBVLSHSV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methoxy-2-[4-(1,3-thiazol-4-yl)-1H-pyrazol-5-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-[4-(1,3-thiazol-4-yl)-1H-pyrazol-5-yl]phenol?
The IUPAC name of 5-methoxy-2-[4-(1,3-thiazol-4-yl)-1H-pyrazol-5-yl]phenol (CID 728350) is 5-methoxy-2-[4-(1,3-thiazol-4-yl)-1H-pyrazol-5-yl]phenol.
What is the SMILES notation for 5-methoxy-2-[4-(1,3-thiazol-4-yl)-1H-pyrazol-5-yl]phenol?
The canonical SMILES for 5-methoxy-2-[4-(1,3-thiazol-4-yl)-1H-pyrazol-5-yl]phenol is COc1ccc(-c2[nH]ncc2-c2cscn2)c(O)c1.
What is the InChIKey of 5-methoxy-2-[4-(1,3-thiazol-4-yl)-1H-pyrazol-5-yl]phenol?
The InChIKey is GKWZJPNBVLSHSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O2S/c1-18-8-2-3-9(12(17)4-8)13-10(5-15-16-13)11-6-19-7-14-11/h2-7,17H,1H3,(H,15,16).
What are the key properties of 5-methoxy-2-[4-(1,3-thiazol-4-yl)-1H-pyrazol-5-yl]phenol?
5-methoxy-2-[4-(1,3-thiazol-4-yl)-1H-pyrazol-5-yl]phenol has a molecular weight of 273.32 g/mol, XLogP of 2.91, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-[4-(1,3-thiazol-4-yl)-1H-pyrazol-5-yl]phenol is sourced from PubChem (CID 728350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).