C23H33N3OS — CID 72836859
(5Z)-5-[(3,5-ditert-butylphenyl)methylidene]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one (PubChem CID 72836859) has the molecular formula C23H33N3OS and a molecular weight of 399.60 g/mol. Its IUPAC name is (5Z)-5-[(3,5-ditert-butylphenyl)methylidene]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[(3,5-ditert-butylphenyl)methylidene]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 72836859 |
| Molecular Formula | C23H33N3OS |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | (5Z)-5-[(3,5-ditert-butylphenyl)methylidene]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one |
| SMILES | CN1CCN(C2=NC(=O)/C(=C/c3cc(C(C)(C)C)cc(C(C)(C)C)c3)S2)CC1 |
| InChI | InChI=1S/C23H33N3OS/c1-22(2,3)17-12-16(13-18(15-17)23(4,5)6)14-19-20(27)24-21(28-19)26-10-8-25(7)9-11-26/h12-15H,8-11H2,1-7H3/b19-14- |
| InChIKey | UWWASVHVWAWYRH-RGEXLXHISA-N |
| XLogP | 4.50 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|