C31H36N4O11 — CID 72836889
N-[3-[[(2S,3R)-2-[(2,3-dihydroxybenzoyl)amino]-3-hydroxybutanoyl]-[3-[(2,3-dihydroxybenzoyl)amino]propyl]amino]propyl]-2,3-dihydroxybenzamide (PubChem CID 72836889) has the molecular formula C31H36N4O11 and a molecular weight of 640.65 g/mol. Its IUPAC name is N-[3-[[(2S,3R)-2-[(2,3-dihydroxybenzoyl)amino]-3-hydroxybutanoyl]-[3-[(2,3-dihydroxybenzoyl)amino]propyl]amino]propyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[3-[[(2S,3R)-2-[(2,3-dihydroxybenzoyl)amino]-3-hydroxybutanoyl]-[3-[(2,3-dihydroxybenzoyl)amino]propyl]amino]propyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 72836889 |
| Molecular Formula | C31H36N4O11 |
| Molecular Weight | 640.65 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | N-[3-[[(2S,3R)-2-[(2,3-dihydroxybenzoyl)amino]-3-hydroxybutanoyl]-[3-[(2,3-dihydroxybenzoyl)amino]propyl]amino]propyl]-2,3-dihydroxybenzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1cccc(O)c1O)C(=O)N(CCCNC(=O)c1cccc(O)c1O)CCCNC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C31H36N4O11/c1-17(36)24(34-30(45)20-9-4-12-23(39)27(20)42)31(46)35(15-5-13-32-28(43)18-7-2-10-21(37)25(18)40)16-6-14-33-29(44)19-8-3-11-22(38)26(19)41/h2-4,7-12,17,24,36-42H,5-6,13-16H2,1H3,(H,32,43)(H,33,44)(H,34,45)/t17-,24+/m1/s1 |
| InChIKey | MWFRACPJMTUCLE-OSPHWJPCSA-N |
| XLogP | 0.87 |
| TPSA | 249.22 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.65 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|