C23H21ClF3N3O2S — CID 72836993
9-methyl-5-[[7-(trifluoromethyl)-1H-indol-5-yl]sulfonyl]-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene;hydrochloride (PubChem CID 72836993) has the molecular formula C23H21ClF3N3O2S and a molecular weight of 495.95 g/mol. Its IUPAC name is 9-methyl-5-[[7-(trifluoromethyl)-1H-indol-5-yl]sulfonyl]-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene;hydrochloride.
| Compound Name | 9-methyl-5-[[7-(trifluoromethyl)-1H-indol-5-yl]sulfonyl]-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene;hydrochloride |
|---|---|
| PubChem CID | 72836993 |
| Molecular Formula | C23H21ClF3N3O2S |
| Molecular Weight | 495.95 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | 9-methyl-5-[[7-(trifluoromethyl)-1H-indol-5-yl]sulfonyl]-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene;hydrochloride |
| SMILES | Cl.Cn1c2c(c3cc(S(=O)(=O)c4cc(C(F)(F)F)c5[nH]ccc5c4)ccc31)C1CCC(C2)N1 |
| InChI | InChI=1S/C23H20F3N3O2S.ClH/c1-29-19-5-3-14(10-16(19)21-18-4-2-13(28-18)9-20(21)29)32(30,31)15-8-12-6-7-27-22(12)17(11-15)23(24,25)26;/h3,5-8,10-11,13,18,27-28H,2,4,9H2,1H3;1H |
| InChIKey | KVDJNMQPOQNCFW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.95 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|