C22H25FN4O — CID 72837955
N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-(2-fluorophenyl)-3-phenylpropanamide (PubChem CID 72837955) has the molecular formula C22H25FN4O and a molecular weight of 380.47 g/mol. Its IUPAC name is N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-(2-fluorophenyl)-3-phenylpropanamide.
| Compound Name | N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-(2-fluorophenyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 72837955 |
| Molecular Formula | C22H25FN4O |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-(2-fluorophenyl)-3-phenylpropanamide |
| SMILES | Cc1nc(C)n(CCCNC(=O)CC(c2ccccc2)c2ccccc2F)n1 |
| InChI | InChI=1S/C22H25FN4O/c1-16-25-17(2)27(26-16)14-8-13-24-22(28)15-20(18-9-4-3-5-10-18)19-11-6-7-12-21(19)23/h3-7,9-12,20H,8,13-15H2,1-2H3,(H,24,28) |
| InChIKey | FTDOTMRYKPZWJH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|