C16H18F3N3O3 — CID 72838298
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-methoxyethyl)-5-(3,3,3-trifluoropropyl)-1,2,4-triazole (PubChem CID 72838298) has the molecular formula C16H18F3N3O3 and a molecular weight of 357.33 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-methoxyethyl)-5-(3,3,3-trifluoropropyl)-1,2,4-triazole.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-methoxyethyl)-5-(3,3,3-trifluoropropyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 72838298 |
| Molecular Formula | C16H18F3N3O3 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-methoxyethyl)-5-(3,3,3-trifluoropropyl)-1,2,4-triazole |
| SMILES | COCCc1nc(CCC(F)(F)F)n(-c2ccc3c(c2)OCCO3)n1 |
| InChI | InChI=1S/C16H18F3N3O3/c1-23-7-5-14-20-15(4-6-16(17,18)19)22(21-14)11-2-3-12-13(10-11)25-9-8-24-12/h2-3,10H,4-9H2,1H3 |
| InChIKey | BGGSMDKWRNMVAK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |