C17H26N4O2 — CID 72838357
9-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]-2-oxa-9-azaspiro[4.5]decane (PubChem CID 72838357) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 9-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]-2-oxa-9-azaspiro[4.5]decane.
| Compound Name | 9-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]-2-oxa-9-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 72838357 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 9-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]-2-oxa-9-azaspiro[4.5]decane |
| SMILES | c1nc(N2CCOCC2)ncc1CN1CCCC2(CCOC2)C1 |
| InChI | InChI=1S/C17H26N4O2/c1-2-17(3-7-23-14-17)13-20(4-1)12-15-10-18-16(19-11-15)21-5-8-22-9-6-21/h10-11H,1-9,12-14H2 |
| InChIKey | KNEYJHYPSUJDGJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |