C19H23N5O3 — CID 72839150
3-[[2-cyclohexyl-5-[hydroxy(phenyl)methyl]-1,2,4-triazol-3-yl]methyl]imidazolidine-2,4-dione (PubChem CID 72839150) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is 3-[[2-cyclohexyl-5-[hydroxy(phenyl)methyl]-1,2,4-triazol-3-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 3-[[2-cyclohexyl-5-[hydroxy(phenyl)methyl]-1,2,4-triazol-3-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 72839150 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 3-[[2-cyclohexyl-5-[hydroxy(phenyl)methyl]-1,2,4-triazol-3-yl]methyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1Cc1nc(C(O)c2ccccc2)nn1C1CCCCC1 |
| InChI | InChI=1S/C19H23N5O3/c25-16-11-20-19(27)23(16)12-15-21-18(17(26)13-7-3-1-4-8-13)22-24(15)14-9-5-2-6-10-14/h1,3-4,7-8,14,17,26H,2,5-6,9-12H2,(H,20,27) |
| InChIKey | URQOYPXHAGNQBT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|