C22H24ClN3O2 — CID 72839599
9-(3-chlorobenzoyl)-2-(pyridin-4-ylmethyl)-2,9-diazaspiro[5.5]undecan-3-one (PubChem CID 72839599) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.91 g/mol. Its IUPAC name is 9-(3-chlorobenzoyl)-2-(pyridin-4-ylmethyl)-2,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 9-(3-chlorobenzoyl)-2-(pyridin-4-ylmethyl)-2,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 72839599 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 9-(3-chlorobenzoyl)-2-(pyridin-4-ylmethyl)-2,9-diazaspiro[5.5]undecan-3-one |
| SMILES | O=C1CCC2(CCN(C(=O)c3cccc(Cl)c3)CC2)CN1Cc1ccncc1 |
| InChI | InChI=1S/C22H24ClN3O2/c23-19-3-1-2-18(14-19)21(28)25-12-8-22(9-13-25)7-4-20(27)26(16-22)15-17-5-10-24-11-6-17/h1-3,5-6,10-11,14H,4,7-9,12-13,15-16H2 |
| InChIKey | SUWUQXNYSDQRDO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |