C20H27NO5 — CID 72839913
(3aS,10aS)-2-(6-methoxyhexanoyl)-3,3a,4,10-tetrahydro-1H-[1]benzoxepino[3,4-c]pyrrole-10a-carboxylic acid (PubChem CID 72839913) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is (3aS,10aS)-2-(6-methoxyhexanoyl)-3,3a,4,10-tetrahydro-1H-[1]benzoxepino[3,4-c]pyrrole-10a-carboxylic acid.
| Compound Name | (3aS,10aS)-2-(6-methoxyhexanoyl)-3,3a,4,10-tetrahydro-1H-[1]benzoxepino[3,4-c]pyrrole-10a-carboxylic acid |
|---|---|
| PubChem CID | 72839913 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | (3aS,10aS)-2-(6-methoxyhexanoyl)-3,3a,4,10-tetrahydro-1H-[1]benzoxepino[3,4-c]pyrrole-10a-carboxylic acid |
| SMILES | COCCCCCC(=O)N1C[C@H]2COc3ccccc3C[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C20H27NO5/c1-25-10-6-2-3-9-18(22)21-12-16-13-26-17-8-5-4-7-15(17)11-20(16,14-21)19(23)24/h4-5,7-8,16H,2-3,6,9-14H2,1H3,(H,23,24)/t16-,20+/m0/s1 |
| InChIKey | UAERTKRTWNAITQ-OXJNMPFZSA-N |
| XLogP | 2.36 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|