C16H24N6O2 — CID 72840946
N-[1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 72840946) has the molecular formula C16H24N6O2 and a molecular weight of 332.41 g/mol. Its IUPAC name is N-[1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | N-[1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 72840946 |
| Molecular Formula | C16H24N6O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | N-[1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | COCCCn1cnnc1C(C)NC(=O)c1n[nH]c2c1CCCC2 |
| InChI | InChI=1S/C16H24N6O2/c1-11(15-21-17-10-22(15)8-5-9-24-2)18-16(23)14-12-6-3-4-7-13(12)19-20-14/h10-11H,3-9H2,1-2H3,(H,18,23)(H,19,20) |
| InChIKey | CTZQNFNQCFCFNZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|