C17H23N5O — CID 72841234
6-[4-(2-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]pyrimidin-4-amine (PubChem CID 72841234) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is 6-[4-(2-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]pyrimidin-4-amine.
| Compound Name | 6-[4-(2-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 72841234 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 6-[4-(2-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]pyrimidin-4-amine |
| SMILES | COc1ccccc1N1CCN(c2cc(N)ncn2)CC1(C)C |
| InChI | InChI=1S/C17H23N5O/c1-17(2)11-21(16-10-15(18)19-12-20-16)8-9-22(17)13-6-4-5-7-14(13)23-3/h4-7,10,12H,8-9,11H2,1-3H3,(H2,18,19,20) |
| InChIKey | FQDKPHACEFLTHG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |