C13H20N6 — CID 72841747
N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-5,6-dimethylpyrimidin-4-amine (PubChem CID 72841747) has the molecular formula C13H20N6 and a molecular weight of 260.34 g/mol. Its IUPAC name is N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-5,6-dimethylpyrimidin-4-amine.
| Compound Name | N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-5,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 72841747 |
| Molecular Formula | C13H20N6 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-5,6-dimethylpyrimidin-4-amine |
| SMILES | Cc1nc(C)n(CCCNc2ncnc(C)c2C)n1 |
| InChI | InChI=1S/C13H20N6/c1-9-10(2)15-8-16-13(9)14-6-5-7-19-12(4)17-11(3)18-19/h8H,5-7H2,1-4H3,(H,14,15,16) |
| InChIKey | HGLZPBOJLNJGOK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|