C18H23N3O3 — CID 72842559
2-[(2,4-dimethoxyphenyl)methyl]-7,7-dimethyl-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one (PubChem CID 72842559) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)methyl]-7,7-dimethyl-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one.
| Compound Name | 2-[(2,4-dimethoxyphenyl)methyl]-7,7-dimethyl-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one |
|---|---|
| PubChem CID | 72842559 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)methyl]-7,7-dimethyl-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one |
| SMILES | COc1ccc(Cc2nc3c([nH]2)CC(C)(C)CNC3=O)c(OC)c1 |
| InChI | InChI=1S/C18H23N3O3/c1-18(2)9-13-16(17(22)19-10-18)21-15(20-13)7-11-5-6-12(23-3)8-14(11)24-4/h5-6,8H,7,9-10H2,1-4H3,(H,19,22)(H,20,21) |
| InChIKey | SFAJAMJLQCAQDX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |