C17H22N6S2 — CID 72842645
1-(1,3-benzothiazol-2-yl)-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]piperidin-4-amine (PubChem CID 72842645) has the molecular formula C17H22N6S2 and a molecular weight of 374.54 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]piperidin-4-amine.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 72842645 |
| Molecular Formula | C17H22N6S2 |
| Molecular Weight | 374.54 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]piperidin-4-amine |
| SMILES | Cc1nc(SCCNC2CCN(c3nc4ccccc4s3)CC2)n[nH]1 |
| InChI | InChI=1S/C17H22N6S2/c1-12-19-16(22-21-12)24-11-8-18-13-6-9-23(10-7-13)17-20-14-4-2-3-5-15(14)25-17/h2-5,13,18H,6-11H2,1H3,(H,19,21,22) |
| InChIKey | ONFRVXURNILQPX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|