About N-[(3R,4S)-1-(3-hydroxypropyl)-4-propylpyrrolidin-3-yl]-2-(4-methylpyrazol-1-yl)acetamide
N-[(3R,4S)-1-(3-hydroxypropyl)-4-propylpyrrolidin-3-yl]-2-(4-methylpyrazol-1-yl)acetamide (PubChem CID 72842986) has the molecular formula C16H28N4O2
and a molecular weight of 308.43 g/mol. Its IUPAC name is N-[(3R,4S)-1-(3-hydroxypropyl)-4-propylpyrrolidin-3-yl]-2-(4-methylpyrazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-[(3R,4S)-1-(3-hydroxypropyl)-4-propylpyrrolidin-3-yl]-2-(4-methylpyrazol-1-yl)acetamide |
| PubChem CID | 72842986 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | N-[(3R,4S)-1-(3-hydroxypropyl)-4-propylpyrrolidin-3-yl]-2-(4-methylpyrazol-1-yl)acetamide |
| SMILES | CCC[C@H]1CN(CCCO)C[C@@H]1NC(=O)Cn1cc(C)cn1 |
| InChI | InChI=1S/C16H28N4O2/c1-3-5-14-10-19(6-4-7-21)11-15(14)18-16(22)12-20-9-13(2)8-17-20/h8-9,14-15,21H,3-7,10-12H2,1-2H3,(H,18,22)/t14-,15-/m0/s1 |
| InChIKey | OBPSRIDGQGFQSD-GJZGRUSLSA-N |
| XLogP | 0.79 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3R,4S)-1-(3-hydroxypropyl)-4-propylpyrrolidin-3-yl]-2-(4-methylpyrazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R,4S)-1-(3-hydroxypropyl)-4-propylpyrrolidin-3-yl]-2-(4-methylpyrazol-1-yl)acetamide?
The IUPAC name of N-[(3R,4S)-1-(3-hydroxypropyl)-4-propylpyrrolidin-3-yl]-2-(4-methylpyrazol-1-yl)acetamide (CID 72842986) is N-[(3R,4S)-1-(3-hydroxypropyl)-4-propylpyrrolidin-3-yl]-2-(4-methylpyrazol-1-yl)acetamide.
What is the SMILES notation for N-[(3R,4S)-1-(3-hydroxypropyl)-4-propylpyrrolidin-3-yl]-2-(4-methylpyrazol-1-yl)acetamide?
The canonical SMILES for N-[(3R,4S)-1-(3-hydroxypropyl)-4-propylpyrrolidin-3-yl]-2-(4-methylpyrazol-1-yl)acetamide is CCC[C@H]1CN(CCCO)C[C@@H]1NC(=O)Cn1cc(C)cn1.
What is the InChIKey of N-[(3R,4S)-1-(3-hydroxypropyl)-4-propylpyrrolidin-3-yl]-2-(4-methylpyrazol-1-yl)acetamide?
The InChIKey is OBPSRIDGQGFQSD-GJZGRUSLSA-N. The full InChI is InChI=1S/C16H28N4O2/c1-3-5-14-10-19(6-4-7-21)11-15(14)18-16(22)12-20-9-13(2)8-17-20/h8-9,14-15,21H,3-7,10-12H2,1-2H3,(H,18,22)/t14-,15-/m0/s1.
What are the key properties of N-[(3R,4S)-1-(3-hydroxypropyl)-4-propylpyrrolidin-3-yl]-2-(4-methylpyrazol-1-yl)acetamide?
N-[(3R,4S)-1-(3-hydroxypropyl)-4-propylpyrrolidin-3-yl]-2-(4-methylpyrazol-1-yl)acetamide has a molecular weight of 308.43 g/mol, XLogP of 0.79, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R,4S)-1-(3-hydroxypropyl)-4-propylpyrrolidin-3-yl]-2-(4-methylpyrazol-1-yl)acetamide is sourced from PubChem (CID 72842986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).