C20H30ClN3O2 — CID 72843000
4-[(4aR,6R,8aS)-2-(5-chloro-2-pyridinyl)-8a-(methoxymethyl)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-6-yl]morpholine (PubChem CID 72843000) has the molecular formula C20H30ClN3O2 and a molecular weight of 379.93 g/mol. Its IUPAC name is 4-[(4aR,6R,8aS)-2-(5-chloro-2-pyridinyl)-8a-(methoxymethyl)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-6-yl]morpholine.
| Compound Name | 4-[(4aR,6R,8aS)-2-(5-chloro-2-pyridinyl)-8a-(methoxymethyl)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-6-yl]morpholine |
|---|---|
| PubChem CID | 72843000 |
| Molecular Formula | C20H30ClN3O2 |
| Molecular Weight | 379.93 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 4-[(4aR,6R,8aS)-2-(5-chloro-2-pyridinyl)-8a-(methoxymethyl)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-6-yl]morpholine |
| SMILES | COC[C@@]12CC[C@@H](N3CCOCC3)C[C@H]1CCN(c1ccc(Cl)cn1)C2 |
| InChI | InChI=1S/C20H30ClN3O2/c1-25-15-20-6-4-18(23-8-10-26-11-9-23)12-16(20)5-7-24(14-20)19-3-2-17(21)13-22-19/h2-3,13,16,18H,4-12,14-15H2,1H3/t16-,18-,20+/m1/s1 |
| InChIKey | FJQHMGANFVZMDT-POAQFYNOSA-N |
| XLogP | 3.08 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.93 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |