About 2-(1,3-benzodioxol-5-yloxymethyl)-N-ethyl-N-(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide
2-(1,3-benzodioxol-5-yloxymethyl)-N-ethyl-N-(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide (PubChem CID 72843100) has the molecular formula C20H19N3O5
and a molecular weight of 381.39 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxymethyl)-N-ethyl-N-(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-5-yloxymethyl)-N-ethyl-N-(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide |
| PubChem CID | 72843100 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxymethyl)-N-ethyl-N-(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide |
| SMILES | CCN(Cc1ccccn1)C(=O)c1coc(COc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C20H19N3O5/c1-2-23(10-14-5-3-4-8-21-14)20(24)16-11-26-19(22-16)12-25-15-6-7-17-18(9-15)28-13-27-17/h3-9,11H,2,10,12-13H2,1H3 |
| InChIKey | JGAAVWHFNCKNOE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 86.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(1,3-benzodioxol-5-yloxymethyl)-N-ethyl-N-(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-5-yloxymethyl)-N-ethyl-N-(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide?
The IUPAC name of 2-(1,3-benzodioxol-5-yloxymethyl)-N-ethyl-N-(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide (CID 72843100) is 2-(1,3-benzodioxol-5-yloxymethyl)-N-ethyl-N-(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 2-(1,3-benzodioxol-5-yloxymethyl)-N-ethyl-N-(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide?
The canonical SMILES for 2-(1,3-benzodioxol-5-yloxymethyl)-N-ethyl-N-(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide is CCN(Cc1ccccn1)C(=O)c1coc(COc2ccc3c(c2)OCO3)n1.
What is the InChIKey of 2-(1,3-benzodioxol-5-yloxymethyl)-N-ethyl-N-(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide?
The InChIKey is JGAAVWHFNCKNOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O5/c1-2-23(10-14-5-3-4-8-21-14)20(24)16-11-26-19(22-16)12-25-15-6-7-17-18(9-15)28-13-27-17/h3-9,11H,2,10,12-13H2,1H3.
What are the key properties of 2-(1,3-benzodioxol-5-yloxymethyl)-N-ethyl-N-(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide?
2-(1,3-benzodioxol-5-yloxymethyl)-N-ethyl-N-(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide has a molecular weight of 381.39 g/mol, XLogP of 3.04, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-yloxymethyl)-N-ethyl-N-(pyridin-2-ylmethyl)-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 72843100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).