C18H25N3O5 — CID 72843140
methyl 2-[4-[(4-butyl-3-oxopiperazine-1-carbonyl)amino]phenoxy]acetate (PubChem CID 72843140) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is methyl 2-[4-[(4-butyl-3-oxopiperazine-1-carbonyl)amino]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(4-butyl-3-oxopiperazine-1-carbonyl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 72843140 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | methyl 2-[4-[(4-butyl-3-oxopiperazine-1-carbonyl)amino]phenoxy]acetate |
| SMILES | CCCCN1CCN(C(=O)Nc2ccc(OCC(=O)OC)cc2)CC1=O |
| InChI | InChI=1S/C18H25N3O5/c1-3-4-9-20-10-11-21(12-16(20)22)18(24)19-14-5-7-15(8-6-14)26-13-17(23)25-2/h5-8H,3-4,9-13H2,1-2H3,(H,19,24) |
| InChIKey | AXEBFNXPPZTWBI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |