About (1-methyl-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl)-(1-propan-2-ylpyrrol-2-yl)methanone
(1-methyl-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl)-(1-propan-2-ylpyrrol-2-yl)methanone (PubChem CID 72843342) has the molecular formula C23H31N3O
and a molecular weight of 365.52 g/mol. Its IUPAC name is (1-methyl-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl)-(1-propan-2-ylpyrrol-2-yl)methanone.
Molecular Properties
| Compound Name | (1-methyl-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl)-(1-propan-2-ylpyrrol-2-yl)methanone |
| PubChem CID | 72843342 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | (1-methyl-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl)-(1-propan-2-ylpyrrol-2-yl)methanone |
| SMILES | CC(C)n1cccc1C(=O)N1CCC2(CC1)CC(c1ccccc1)CN2C |
| InChI | InChI=1S/C23H31N3O/c1-18(2)26-13-7-10-21(26)22(27)25-14-11-23(12-15-25)16-20(17-24(23)3)19-8-5-4-6-9-19/h4-10,13,18,20H,11-12,14-17H2,1-3H3 |
| InChIKey | OPUXRRPVVHNDLT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-methyl-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl)-(1-propan-2-ylpyrrol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl)-(1-propan-2-ylpyrrol-2-yl)methanone?
The IUPAC name of (1-methyl-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl)-(1-propan-2-ylpyrrol-2-yl)methanone (CID 72843342) is (1-methyl-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl)-(1-propan-2-ylpyrrol-2-yl)methanone.
What is the SMILES notation for (1-methyl-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl)-(1-propan-2-ylpyrrol-2-yl)methanone?
The canonical SMILES for (1-methyl-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl)-(1-propan-2-ylpyrrol-2-yl)methanone is CC(C)n1cccc1C(=O)N1CCC2(CC1)CC(c1ccccc1)CN2C.
What is the InChIKey of (1-methyl-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl)-(1-propan-2-ylpyrrol-2-yl)methanone?
The InChIKey is OPUXRRPVVHNDLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31N3O/c1-18(2)26-13-7-10-21(26)22(27)25-14-11-23(12-15-25)16-20(17-24(23)3)19-8-5-4-6-9-19/h4-10,13,18,20H,11-12,14-17H2,1-3H3.
What are the key properties of (1-methyl-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl)-(1-propan-2-ylpyrrol-2-yl)methanone?
(1-methyl-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl)-(1-propan-2-ylpyrrol-2-yl)methanone has a molecular weight of 365.52 g/mol, XLogP of 4.16, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl)-(1-propan-2-ylpyrrol-2-yl)methanone is sourced from PubChem (CID 72843342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).