C18H26N6O — CID 72843536
1-(1-cyclopentyl-4-methylpyrazol-5-yl)-3-[3-(pyridin-3-ylamino)propyl]urea (PubChem CID 72843536) has the molecular formula C18H26N6O and a molecular weight of 342.45 g/mol. Its IUPAC name is 1-(1-cyclopentyl-4-methylpyrazol-5-yl)-3-[3-(pyridin-3-ylamino)propyl]urea.
| Compound Name | 1-(1-cyclopentyl-4-methylpyrazol-5-yl)-3-[3-(pyridin-3-ylamino)propyl]urea |
|---|---|
| PubChem CID | 72843536 |
| Molecular Formula | C18H26N6O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 1-(1-cyclopentyl-4-methylpyrazol-5-yl)-3-[3-(pyridin-3-ylamino)propyl]urea |
| SMILES | Cc1cnn(C2CCCC2)c1NC(=O)NCCCNc1cccnc1 |
| InChI | InChI=1S/C18H26N6O/c1-14-12-22-24(16-7-2-3-8-16)17(14)23-18(25)21-11-5-10-20-15-6-4-9-19-13-15/h4,6,9,12-13,16,20H,2-3,5,7-8,10-11H2,1H3,(H2,21,23,25) |
| InChIKey | FEGAXTAXEVFKNL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|