About 3-methyl-1-propyl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide
3-methyl-1-propyl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide (PubChem CID 72843899) has the molecular formula C10H14F3N3O
and a molecular weight of 249.24 g/mol. Its IUPAC name is 3-methyl-1-propyl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-methyl-1-propyl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide |
| PubChem CID | 72843899 |
| Molecular Formula | C10H14F3N3O |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 3-methyl-1-propyl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide |
| SMILES | CCCn1cc(C(=O)NCC(F)(F)F)c(C)n1 |
| InChI | InChI=1S/C10H14F3N3O/c1-3-4-16-5-8(7(2)15-16)9(17)14-6-10(11,12)13/h5H,3-4,6H2,1-2H3,(H,14,17) |
| InChIKey | VYAIKPSPPLHXIR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-1-propyl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-propyl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide?
The IUPAC name of 3-methyl-1-propyl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide (CID 72843899) is 3-methyl-1-propyl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide.
What is the SMILES notation for 3-methyl-1-propyl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide?
The canonical SMILES for 3-methyl-1-propyl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide is CCCn1cc(C(=O)NCC(F)(F)F)c(C)n1.
What is the InChIKey of 3-methyl-1-propyl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide?
The InChIKey is VYAIKPSPPLHXIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3N3O/c1-3-4-16-5-8(7(2)15-16)9(17)14-6-10(11,12)13/h5H,3-4,6H2,1-2H3,(H,14,17).
What are the key properties of 3-methyl-1-propyl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide?
3-methyl-1-propyl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide has a molecular weight of 249.24 g/mol, XLogP of 1.89, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-propyl-N-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide is sourced from PubChem (CID 72843899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).