3-[1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]benzoic acid

C16H18N2O2S — CID 72844091

IUPAC3-[1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]benzoic acid
SMILESO=C(O)c1cccc(C2CCCN(Cc3nccs3)C2)c1
InChIInChI=1S/C16H18N2O2S/c19-16(20)13-4-1-3-12(9-13)14-5-2-7-18(10-14)11-15-17-6-8-21-15/h1,3-4,6,8-9,14H,2,5,7,10-11H2,(H,19,20)
InChIKeyPGSQJRNZSDKSRF-UHFFFAOYSA-N
MW302.40 g/mol
LogP3.22
Rot. Bonds4

About 3-[1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]benzoic acid

3-[1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]benzoic acid (PubChem CID 72844091) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 3-[1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]benzoic acid.

Molecular Properties

Compound Name3-[1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]benzoic acid
PubChem CID72844091
Molecular FormulaC16H18N2O2S
Molecular Weight302.40 g/mol
Exact Mass302.11
IUPAC Name3-[1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]benzoic acid
SMILESO=C(O)c1cccc(C2CCCN(Cc3nccs3)C2)c1
InChIInChI=1S/C16H18N2O2S/c19-16(20)13-4-1-3-12(9-13)14-5-2-7-18(10-14)11-15-17-6-8-21-15/h1,3-4,6,8-9,14H,2,5,7,10-11H2,(H,19,20)
InChIKeyPGSQJRNZSDKSRF-UHFFFAOYSA-N
XLogP3.22
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.40
LogP ≤ 53.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]benzoic acid?
The IUPAC name of 3-[1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]benzoic acid (CID 72844091) is 3-[1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]benzoic acid.
What is the SMILES notation for 3-[1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]benzoic acid?
The canonical SMILES for 3-[1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]benzoic acid is O=C(O)c1cccc(C2CCCN(Cc3nccs3)C2)c1.
What is the InChIKey of 3-[1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]benzoic acid?
The InChIKey is PGSQJRNZSDKSRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2S/c19-16(20)13-4-1-3-12(9-13)14-5-2-7-18(10-14)11-15-17-6-8-21-15/h1,3-4,6,8-9,14H,2,5,7,10-11H2,(H,19,20).
What are the key properties of 3-[1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]benzoic acid?
3-[1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]benzoic acid has a molecular weight of 302.40 g/mol, XLogP of 3.22, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(1,3-thiazol-2-ylmethyl)piperidin-3-yl]benzoic acid is sourced from PubChem (CID 72844091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).