About 1-cyclopentyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-6-oxopiperidine-3-carboxamide
1-cyclopentyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-6-oxopiperidine-3-carboxamide (PubChem CID 72844521) has the molecular formula C19H28N4O3
and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-cyclopentyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-6-oxopiperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-cyclopentyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-6-oxopiperidine-3-carboxamide |
| PubChem CID | 72844521 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-cyclopentyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-6-oxopiperidine-3-carboxamide |
| SMILES | Cc1cc(C)n(CCNC(=O)C2CCC(=O)N(C3CCCC3)C2)c(=O)n1 |
| InChI | InChI=1S/C19H28N4O3/c1-13-11-14(2)22(19(26)21-13)10-9-20-18(25)15-7-8-17(24)23(12-15)16-5-3-4-6-16/h11,15-16H,3-10,12H2,1-2H3,(H,20,25) |
| InChIKey | DSMVCHJHHQWQBH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-cyclopentyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-6-oxopiperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-6-oxopiperidine-3-carboxamide?
The IUPAC name of 1-cyclopentyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-6-oxopiperidine-3-carboxamide (CID 72844521) is 1-cyclopentyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-6-oxopiperidine-3-carboxamide.
What is the SMILES notation for 1-cyclopentyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-6-oxopiperidine-3-carboxamide?
The canonical SMILES for 1-cyclopentyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-6-oxopiperidine-3-carboxamide is Cc1cc(C)n(CCNC(=O)C2CCC(=O)N(C3CCCC3)C2)c(=O)n1.
What is the InChIKey of 1-cyclopentyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-6-oxopiperidine-3-carboxamide?
The InChIKey is DSMVCHJHHQWQBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N4O3/c1-13-11-14(2)22(19(26)21-13)10-9-20-18(25)15-7-8-17(24)23(12-15)16-5-3-4-6-16/h11,15-16H,3-10,12H2,1-2H3,(H,20,25).
What are the key properties of 1-cyclopentyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-6-oxopiperidine-3-carboxamide?
1-cyclopentyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-6-oxopiperidine-3-carboxamide has a molecular weight of 360.46 g/mol, XLogP of 1.16, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-6-oxopiperidine-3-carboxamide is sourced from PubChem (CID 72844521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).