C16H25N5O3S — CID 72844597
[(4aS,7aR)-6,6-dioxo-1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cyclopropylmethanone (PubChem CID 72844597) has the molecular formula C16H25N5O3S and a molecular weight of 367.48 g/mol. Its IUPAC name is [(4aS,7aR)-6,6-dioxo-1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cyclopropylmethanone.
| Compound Name | [(4aS,7aR)-6,6-dioxo-1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 72844597 |
| Molecular Formula | C16H25N5O3S |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | [(4aS,7aR)-6,6-dioxo-1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cyclopropylmethanone |
| SMILES | CC(C)n1cnnc1CN1CCN(C(=O)C2CC2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C16H25N5O3S/c1-11(2)21-10-17-18-15(21)7-19-5-6-20(16(22)12-3-4-12)14-9-25(23,24)8-13(14)19/h10-14H,3-9H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | KKEXFZFGPAGUAL-UONOGXRCSA-N |
| XLogP | 0.08 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |