C18H25N5 — CID 72844659
N-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-5,7-dimethylpyrido[2,3-d]pyrimidin-4-amine (PubChem CID 72844659) has the molecular formula C18H25N5 and a molecular weight of 311.43 g/mol. Its IUPAC name is N-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-5,7-dimethylpyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-5,7-dimethylpyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 72844659 |
| Molecular Formula | C18H25N5 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | N-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-5,7-dimethylpyrido[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc(C)c2c(NCCC34CCCN3CCC4)ncnc2n1 |
| InChI | InChI=1S/C18H25N5/c1-13-11-14(2)22-17-15(13)16(20-12-21-17)19-8-7-18-5-3-9-23(18)10-4-6-18/h11-12H,3-10H2,1-2H3,(H,19,20,21,22) |
| InChIKey | FQHFGJROGQCPMP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |