About [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-[2-(methylamino)pyrimidin-5-yl]methanone
[(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-[2-(methylamino)pyrimidin-5-yl]methanone (PubChem CID 72844752) has the molecular formula C13H19N5O
and a molecular weight of 261.33 g/mol. Its IUPAC name is [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-[2-(methylamino)pyrimidin-5-yl]methanone.
Molecular Properties
| Compound Name | [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-[2-(methylamino)pyrimidin-5-yl]methanone |
| PubChem CID | 72844752 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-[2-(methylamino)pyrimidin-5-yl]methanone |
| SMILES | CNc1ncc(C(=O)N2C[C@H](C3CC3)[C@@H](N)C2)cn1 |
| InChI | InChI=1S/C13H19N5O/c1-15-13-16-4-9(5-17-13)12(19)18-6-10(8-2-3-8)11(14)7-18/h4-5,8,10-11H,2-3,6-7,14H2,1H3,(H,15,16,17)/t10-,11+/m1/s1 |
| InChIKey | IEFYPAJVUXGITE-MNOVXSKESA-N |
| XLogP | 0.33 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-[2-(methylamino)pyrimidin-5-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-[2-(methylamino)pyrimidin-5-yl]methanone?
The IUPAC name of [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-[2-(methylamino)pyrimidin-5-yl]methanone (CID 72844752) is [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-[2-(methylamino)pyrimidin-5-yl]methanone.
What is the SMILES notation for [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-[2-(methylamino)pyrimidin-5-yl]methanone?
The canonical SMILES for [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-[2-(methylamino)pyrimidin-5-yl]methanone is CNc1ncc(C(=O)N2C[C@H](C3CC3)[C@@H](N)C2)cn1.
What is the InChIKey of [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-[2-(methylamino)pyrimidin-5-yl]methanone?
The InChIKey is IEFYPAJVUXGITE-MNOVXSKESA-N. The full InChI is InChI=1S/C13H19N5O/c1-15-13-16-4-9(5-17-13)12(19)18-6-10(8-2-3-8)11(14)7-18/h4-5,8,10-11H,2-3,6-7,14H2,1H3,(H,15,16,17)/t10-,11+/m1/s1.
What are the key properties of [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-[2-(methylamino)pyrimidin-5-yl]methanone?
[(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-[2-(methylamino)pyrimidin-5-yl]methanone has a molecular weight of 261.33 g/mol, XLogP of 0.33, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-[2-(methylamino)pyrimidin-5-yl]methanone is sourced from PubChem (CID 72844752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).