C22H23F2N3O2 — CID 72845283
1-[(2R,3S,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-2-(1-methylpyrrol-2-yl)ethane-1,2-dione (PubChem CID 72845283) has the molecular formula C22H23F2N3O2 and a molecular weight of 399.44 g/mol. Its IUPAC name is 1-[(2R,3S,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-2-(1-methylpyrrol-2-yl)ethane-1,2-dione.
| Compound Name | 1-[(2R,3S,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-2-(1-methylpyrrol-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 72845283 |
| Molecular Formula | C22H23F2N3O2 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 1-[(2R,3S,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-2-(1-methylpyrrol-2-yl)ethane-1,2-dione |
| SMILES | Cn1cccc1C(=O)C(=O)N1C[C@H](c2cc(F)cc(F)c2)[C@@H]2[C@H]1C1CCN2CC1 |
| InChI | InChI=1S/C22H23F2N3O2/c1-25-6-2-3-18(25)21(28)22(29)27-12-17(14-9-15(23)11-16(24)10-14)20-19(27)13-4-7-26(20)8-5-13/h2-3,6,9-11,13,17,19-20H,4-5,7-8,12H2,1H3/t17-,19-,20-/m1/s1 |
| InChIKey | FBXKKZGKLFJIMB-MISYRCLQSA-N |
| XLogP | 2.57 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|