About 1-acetyl-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-3-carboxamide
1-acetyl-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-3-carboxamide (PubChem CID 72845553) has the molecular formula C17H28N4O2
and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-acetyl-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-acetyl-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-3-carboxamide |
| PubChem CID | 72845553 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 1-acetyl-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-3-carboxamide |
| SMILES | CCn1nc(C)c(CCNC(=O)C2CCCN(C(C)=O)C2)c1C |
| InChI | InChI=1S/C17H28N4O2/c1-5-21-13(3)16(12(2)19-21)8-9-18-17(23)15-7-6-10-20(11-15)14(4)22/h15H,5-11H2,1-4H3,(H,18,23) |
| InChIKey | TZWPGYHOSNCQQN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-acetyl-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-3-carboxamide?
The IUPAC name of 1-acetyl-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-3-carboxamide (CID 72845553) is 1-acetyl-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-3-carboxamide.
What is the SMILES notation for 1-acetyl-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-3-carboxamide?
The canonical SMILES for 1-acetyl-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-3-carboxamide is CCn1nc(C)c(CCNC(=O)C2CCCN(C(C)=O)C2)c1C.
What is the InChIKey of 1-acetyl-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-3-carboxamide?
The InChIKey is TZWPGYHOSNCQQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N4O2/c1-5-21-13(3)16(12(2)19-21)8-9-18-17(23)15-7-6-10-20(11-15)14(4)22/h15H,5-11H2,1-4H3,(H,18,23).
What are the key properties of 1-acetyl-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-3-carboxamide?
1-acetyl-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-3-carboxamide has a molecular weight of 320.44 g/mol, XLogP of 1.44, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-3-carboxamide is sourced from PubChem (CID 72845553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).