C19H26N4O4 — CID 72845569
1-[3-oxo-3-(3-oxo-2-prop-2-enyl-2,9-diazaspiro[5.5]undecan-9-yl)propyl]pyrimidine-2,4-dione (PubChem CID 72845569) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 1-[3-oxo-3-(3-oxo-2-prop-2-enyl-2,9-diazaspiro[5.5]undecan-9-yl)propyl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-oxo-3-(3-oxo-2-prop-2-enyl-2,9-diazaspiro[5.5]undecan-9-yl)propyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 72845569 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 1-[3-oxo-3-(3-oxo-2-prop-2-enyl-2,9-diazaspiro[5.5]undecan-9-yl)propyl]pyrimidine-2,4-dione |
| SMILES | C=CCN1CC2(CCC1=O)CCN(C(=O)CCn1ccc(=O)[nH]c1=O)CC2 |
| InChI | InChI=1S/C19H26N4O4/c1-2-9-23-14-19(6-3-16(23)25)7-12-21(13-8-19)17(26)5-11-22-10-4-15(24)20-18(22)27/h2,4,10H,1,3,5-9,11-14H2,(H,20,24,27) |
| InChIKey | FFOGLJDZOSQUMP-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|