C15H19F3N4O2 — CID 72846149
3,5-dimethyl-4-[[5-(oxan-4-yl)-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]methyl]-1,2-oxazole (PubChem CID 72846149) has the molecular formula C15H19F3N4O2 and a molecular weight of 344.34 g/mol. Its IUPAC name is 3,5-dimethyl-4-[[5-(oxan-4-yl)-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]methyl]-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-[[5-(oxan-4-yl)-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 72846149 |
| Molecular Formula | C15H19F3N4O2 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 3,5-dimethyl-4-[[5-(oxan-4-yl)-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]methyl]-1,2-oxazole |
| SMILES | Cc1noc(C)c1Cc1nc(C2CCOCC2)nn1CC(F)(F)F |
| InChI | InChI=1S/C15H19F3N4O2/c1-9-12(10(2)24-21-9)7-13-19-14(11-3-5-23-6-4-11)20-22(13)8-15(16,17)18/h11H,3-8H2,1-2H3 |
| InChIKey | WMHSFHXYCHELAO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |